CAS 17724-11-7 is the registry number for Calcium Dobesilate Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dihydroxybenzene-1,3-disulfonic acid (CAS 17724-11-7) is a chemical compound with the molecular formula C6H6O8S2 and a molecular weight of 270.2 g/mol. IUPAC name: 4,6-dihydroxybenzene-1,3-disulfonic acid. InChIKey: VWXVJYKCCPSYRD-UHFFFAOYSA-N.
| Molecular formula | C6H6O8S2 |
|---|---|
| Molecular weight | 270.2 g/mol |
| IUPAC name | 4,6-dihydroxybenzene-1,3-disulfonic acid |
| InChIKey | VWXVJYKCCPSYRD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1O)S(=O)(=O)O)S(=O)(=O)O)O |
Computed by PubChem (NCBI)