CAS 4444-23-9 appears in our catalog under these names: Calcium Dobesilate Impurity 11, Calcium Dobesilate Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dihydroxybenzene-1,4-disulfonic acid (CAS 4444-23-9) is a chemical compound with the molecular formula C6H6O8S2 and a molecular weight of 270.2 g/mol. IUPAC name: 2,5-dihydroxybenzene-1,4-disulfonic acid. InChIKey: VSAZFRKEFQPOIS-UHFFFAOYSA-N.
| Molecular formula | C6H6O8S2 |
|---|---|
| Molecular weight | 270.2 g/mol |
| IUPAC name | 2,5-dihydroxybenzene-1,4-disulfonic acid |
| InChIKey | VSAZFRKEFQPOIS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)O)O)S(=O)(=O)O)O |
Computed by PubChem (NCBI)