CAS 1773507-84-8 appears in our catalog under these names: 2-(3,3-Difluorocyclobutyl)-2-methylpropanoic acid, 98%, 2-(3,3-Difluorocyclobutyl)-2-methylpropanoic acid, 97%, 97%, 2-(3,3-DIFLUOROCYCLOBUTYL)-2-METHYLPROPANOIC ACID, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
2-(3,3-difluorocyclobutyl)-2-methylpropanoic acid (CAS 1773507-84-8) is a chemical compound with the molecular formula C8H12F2O2 and a molecular weight of 178.18 g/mol. IUPAC name: 2-(3,3-difluorocyclobutyl)-2-methylpropanoic acid. InChIKey: CRKYZUMKAXCYHR-UHFFFAOYSA-N.
| Molecular formula | C8H12F2O2 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 2-(3,3-difluorocyclobutyl)-2-methylpropanoic acid |
| InChIKey | CRKYZUMKAXCYHR-UHFFFAOYSA-N |
| SMILES | CC(C)(C1CC(C1)(F)F)C(=O)O |
Computed by PubChem (NCBI)