CAS 2199500-21-3 is the registry number for rel-(1S,5S)-3,3-Difluoro-5-methylcyclohexane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1S,5S)-3,3-difluoro-5-methylcyclohexane-1-carboxylic acid (CAS 2199500-21-3) is a chemical compound with the molecular formula C8H12F2O2 and a molecular weight of 178.18 g/mol. IUPAC name: trans-(1S,5S)-3,3-difluoro-5-methylcyclohexane-1-carboxylic acid. InChIKey: FGDOYBLONFFUMM-WDSKDSINSA-N.
| Molecular formula | C8H12F2O2 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | trans-(1S,5S)-3,3-difluoro-5-methylcyclohexane-1-carboxylic acid |
| InChIKey | FGDOYBLONFFUMM-WDSKDSINSA-N |
| SMILES | C[C@H]1C[C@@H](CC(C1)(F)F)C(=O)O |
Computed by PubChem (NCBI)