Products 1773508-02-3

CAS 1773508-02-3 is the registry number for trans-3-(difluoromethyl)cyclobutane-1-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

3-(difluoromethyl)cyclobutane-1-carboxylic acid (CAS 1773508-02-3) is a chemical compound with the molecular formula C6H8F2O2 and a molecular weight of 150.12 g/mol. IUPAC name: 3-(difluoromethyl)cyclobutane-1-carboxylic acid. InChIKey: XRSUGPIWOGKMJP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8F2O2
Molecular weight150.12 g/mol
IUPAC name3-(difluoromethyl)cyclobutane-1-carboxylic acid
InChIKeyXRSUGPIWOGKMJP-UHFFFAOYSA-N
SMILESC1C(CC1C(=O)O)C(F)F

Computed by PubChem (NCBI)