CAS 17740-41-9 is the registry number for 3,8-Dibenzyl-3,8-diazabicyclo[3.2.1]octane-2,4-dione hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,8-dibenzyl-3,8-diazabicyclo[3.2.1]octane-2,4-dione;hydrochloride (CAS 17740-41-9) is a chemical compound with the molecular formula C20H21ClN2O2 and a molecular weight of 356.8 g/mol. IUPAC name: 3,8-dibenzyl-3,8-diazabicyclo[3.2.1]octane-2,4-dione;hydrochloride. InChIKey: OXEVNARZZHOTNJ-UHFFFAOYSA-N.
| Molecular formula | C20H21ClN2O2 |
|---|---|
| Molecular weight | 356.8 g/mol |
| IUPAC name | 3,8-dibenzyl-3,8-diazabicyclo[3.2.1]octane-2,4-dione;hydrochloride |
| InChIKey | OXEVNARZZHOTNJ-UHFFFAOYSA-N |
| SMILES | C1CC2C(=O)N(C(=O)C1N2CC3=CC=CC=C3)CC4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)