CAS 298685-88-8 is the registry number for 4-Chloro-2-((2-methyl-1H-indol-3-yl)(morpholin-4-yl)methyl)phenol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-2-[(2-methyl-1H-indol-3-yl)-morpholin-4-ylmethyl]phenol (CAS 298685-88-8) is a chemical compound with the molecular formula C20H21ClN2O2 and a molecular weight of 356.8 g/mol. IUPAC name: 4-chloro-2-[(2-methyl-1H-indol-3-yl)-morpholin-4-ylmethyl]phenol. InChIKey: GSYUMYRERJFRPI-UHFFFAOYSA-N.
| Molecular formula | C20H21ClN2O2 |
|---|---|
| Molecular weight | 356.8 g/mol |
| IUPAC name | 4-chloro-2-[(2-methyl-1H-indol-3-yl)-morpholin-4-ylmethyl]phenol |
| InChIKey | GSYUMYRERJFRPI-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1)C(C3=C(C=CC(=C3)Cl)O)N4CCOCC4 |
Computed by PubChem (NCBI)