CAS 1774366-61-8 is the registry number for (R)-8-(2-Amino-1-((trimethylsilyl)oxy)ethyl)-2H-benzo[b][1,4]oxazin-3(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-[(1R)-2-amino-1-trimethylsilyloxyethyl]-4H-1,4-benzoxazin-3-one (CAS 1774366-61-8) is a chemical compound with the molecular formula C13H20N2O3Si and a molecular weight of 280.39 g/mol. IUPAC name: 8-[(1R)-2-amino-1-trimethylsilyloxyethyl]-4H-1,4-benzoxazin-3-one. InChIKey: MLJJBKIIPRSSIT-NSHDSACASA-N.
| Molecular formula | C13H20N2O3Si |
|---|---|
| Molecular weight | 280.39 g/mol |
| IUPAC name | 8-[(1R)-2-amino-1-trimethylsilyloxyethyl]-4H-1,4-benzoxazin-3-one |
| InChIKey | MLJJBKIIPRSSIT-NSHDSACASA-N |
| SMILES | C[Si](C)(C)O[C@@H](CN)C1=C2C(=CC=C1)NC(=O)CO2 |
Computed by PubChem (NCBI)