CAS 2173992-53-3 is the registry number for 5-Hydroxy-1-((2-(trimethylsilyl)ethoxy)methyl)-1,3-dihydro-2H-benzo[d]imidazol-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-hydroxy-3-(2-trimethylsilylethoxymethyl)-1H-benzimidazol-2-one (CAS 2173992-53-3) is a chemical compound with the molecular formula C13H20N2O3Si and a molecular weight of 280.39 g/mol. IUPAC name: 6-hydroxy-3-(2-trimethylsilylethoxymethyl)-1H-benzimidazol-2-one. InChIKey: NVNAFLWMVOXZIU-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O3Si |
|---|---|
| Molecular weight | 280.39 g/mol |
| IUPAC name | 6-hydroxy-3-(2-trimethylsilylethoxymethyl)-1H-benzimidazol-2-one |
| InChIKey | NVNAFLWMVOXZIU-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOCN1C2=C(C=C(C=C2)O)NC1=O |
Computed by PubChem (NCBI)