CAS 1774369-60-6 is the registry number for 4-(4-Bromophenyl)-1-(cyclopropylsulfonyl)piperidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-(4-bromophenyl)-1-cyclopropylsulfonylpiperidine (CAS 1774369-60-6) is a chemical compound with the molecular formula C14H18BrNO2S and a molecular weight of 344.27 g/mol. IUPAC name: 4-(4-bromophenyl)-1-cyclopropylsulfonylpiperidine. InChIKey: RQZQSWAWJHCCMY-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO2S |
|---|---|
| Molecular weight | 344.27 g/mol |
| IUPAC name | 4-(4-bromophenyl)-1-cyclopropylsulfonylpiperidine |
| InChIKey | RQZQSWAWJHCCMY-UHFFFAOYSA-N |
| SMILES | C1CC1S(=O)(=O)N2CCC(CC2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)