Products 2845280-30-8

CAS 2845280-30-8 is the registry number for 8-Bromo-4-Boc-2,3,4,5-tetrahydrobenzo[f][1,4]thiazepine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 8-bromo-3,5-dihydro-2H-1,4-benzothiazepine-4-carboxylate (CAS 2845280-30-8) is a chemical compound with the molecular formula C14H18BrNO2S and a molecular weight of 344.27 g/mol. IUPAC name: tert-butyl 8-bromo-3,5-dihydro-2H-1,4-benzothiazepine-4-carboxylate. InChIKey: PLBMFAHTUVKLME-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18BrNO2S
Molecular weight344.27 g/mol
IUPAC nametert-butyl 8-bromo-3,5-dihydro-2H-1,4-benzothiazepine-4-carboxylate
InChIKeyPLBMFAHTUVKLME-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCSC2=C(C1)C=CC(=C2)Br

Computed by PubChem (NCBI)