CAS 1774895-80-5 is the registry number for 3-(3,3-Difluoroazetidin-1-yl)picolinaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,3-difluoroazetidin-1-yl)pyridine-2-carbaldehyde (CAS 1774895-80-5) is a chemical compound with the molecular formula C9H8F2N2O and a molecular weight of 198.17 g/mol. IUPAC name: 3-(3,3-difluoroazetidin-1-yl)pyridine-2-carbaldehyde. InChIKey: HWWWORHIAGVOEJ-UHFFFAOYSA-N.
| Molecular formula | C9H8F2N2O |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 3-(3,3-difluoroazetidin-1-yl)pyridine-2-carbaldehyde |
| InChIKey | HWWWORHIAGVOEJ-UHFFFAOYSA-N |
| SMILES | C1C(CN1C2=C(N=CC=C2)C=O)(F)F |
Computed by PubChem (NCBI)