CAS 929974-21-0 is the registry number for (1-(Difluoromethyl)-1H-1,3-benzodiazol-2-yl)methanol, 95%. Offered by: AmBeed. Available pack sizes: 5g.
[1-(difluoromethyl)benzimidazol-2-yl]methanol (CAS 929974-21-0) is a chemical compound with the molecular formula C9H8F2N2O and a molecular weight of 198.17 g/mol. IUPAC name: [1-(difluoromethyl)benzimidazol-2-yl]methanol. InChIKey: YOTSXVUDIFYTGT-UHFFFAOYSA-N.
| Molecular formula | C9H8F2N2O |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | [1-(difluoromethyl)benzimidazol-2-yl]methanol |
| InChIKey | YOTSXVUDIFYTGT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(N2C(F)F)CO |
Computed by PubChem (NCBI)