CAS 1774896-08-0 is the registry number for tert–Butyl2–(2–fluorophenyl)–4–oxo–1,3,8–triazaspiro(4·5)dec–1–ene–8–carboxylate. Offered by: GLPBio. Available pack sizes: 1g.
Tert-butyl 2-(2-fluorophenyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate (CAS 1774896-08-0) is a chemical compound with the molecular formula C18H22FN3O3 and a molecular weight of 347.4 g/mol. IUPAC name: tert-butyl 2-(2-fluorophenyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate. InChIKey: GAOYLLQAKWUZOA-UHFFFAOYSA-N.
| Molecular formula | C18H22FN3O3 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | tert-butyl 2-(2-fluorophenyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate |
| InChIKey | GAOYLLQAKWUZOA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C(=O)NC(=N2)C3=CC=CC=C3F |
Computed by PubChem (NCBI)