Products 74011-47-5

CAS 74011-47-5 is the registry number for Norfloxacin Ethyl Ester. Offered by: Mikromol. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

Ethyl 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylate (CAS 74011-47-5) is a chemical compound with the molecular formula C18H22FN3O3 and a molecular weight of 347.4 g/mol. IUPAC name: ethyl 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylate. InChIKey: WKZAVCCKKJQNCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H22FN3O3
Molecular weight347.4 g/mol
IUPAC nameethyl 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylate
InChIKeyWKZAVCCKKJQNCJ-UHFFFAOYSA-N
SMILESCCN1C=C(C(=O)C2=CC(=C(C=C21)N3CCNCC3)F)C(=O)OCC

Computed by PubChem (NCBI)