CAS 1774904-83-4 appears in our catalog under these names: 6-Fluorospiro[indoline-3,4'-piperidin]-2-one hydrochloride, 95%, 6-Fluorospiro(indoline-3,4'-piperidin)-2-one hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
6-fluorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride (CAS 1774904-83-4) is a chemical compound with the molecular formula C12H14ClFN2O and a molecular weight of 256.70 g/mol. IUPAC name: 6-fluorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride. InChIKey: XXILKEKYARNVTN-UHFFFAOYSA-N.
| Molecular formula | C12H14ClFN2O |
|---|---|
| Molecular weight | 256.70 g/mol |
| IUPAC name | 6-fluorospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride |
| InChIKey | XXILKEKYARNVTN-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(C=C(C=C3)F)NC2=O.Cl |
Computed by PubChem (NCBI)