CAS 1787079-68-8 appears in our catalog under these names: (R)-7-Fluoro-2-(pyrrolidin-3-yl)isoindolin-1-one hydrochloride, 95%, (R)-7-Fluoro-2-(pyrrolidin-3-yl)isoindolin-1-one hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
7-fluoro-2-[(3R)-pyrrolidin-3-yl]-3H-isoindol-1-one;hydrochloride (CAS 1787079-68-8) is a chemical compound with the molecular formula C12H14ClFN2O and a molecular weight of 256.70 g/mol. IUPAC name: 7-fluoro-2-[(3R)-pyrrolidin-3-yl]-3H-isoindol-1-one;hydrochloride. InChIKey: FVURYUNLMVVKGE-SBSPUUFOSA-N.
| Molecular formula | C12H14ClFN2O |
|---|---|
| Molecular weight | 256.70 g/mol |
| IUPAC name | 7-fluoro-2-[(3R)-pyrrolidin-3-yl]-3H-isoindol-1-one;hydrochloride |
| InChIKey | FVURYUNLMVVKGE-SBSPUUFOSA-N |
| SMILES | C1CNC[C@@H]1N2CC3=C(C2=O)C(=CC=C3)F.Cl |
Computed by PubChem (NCBI)