Products 1776116-74-5
CAS 1776116-74-5 appears in our catalog under these names: MC1742 >= 98 % HPLC 5 Mg, MC1742, MC1742, 98%, MC 1742, MC1742, 98.95%. Offered by: Sigma-Aldrich, GLPBio, AmBeed, TargetMol, Biosynth. Available pack sizes: 5MG, 100mg, 2mg, 1mg, 10mg, 25mg, 50mg, 10 mg.
N-hydroxy-5-[[6-oxo-4-(4-phenylphenyl)-1H-pyrimidin-2-yl]sulfanyl]pentanamide (CAS 1776116-74-5) is a chemical compound with the molecular formula C21H21N3O3S and a molecular weight of 395.5 g/mol. IUPAC name: N-hydroxy-5-[[6-oxo-4-(4-phenylphenyl)-1H-pyrimidin-2-yl]sulfanyl]pentanamide. InChIKey: AOFVDNFTELWRHV-UHFFFAOYSA-N.
| Molecular formula | C21H21N3O3S |
|---|---|
| Molecular weight | 395.5 g/mol |
| IUPAC name | N-hydroxy-5-[[6-oxo-4-(4-phenylphenyl)-1H-pyrimidin-2-yl]sulfanyl]pentanamide |
| InChIKey | AOFVDNFTELWRHV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC(=O)NC(=N3)SCCCCC(=O)NO |
Computed by PubChem (NCBI)