CAS 266359-45-9 is the registry number for Fmoc-L-Met-CHN2. Offered by: Creative Peptides. Available pack sizes: 1g.
9H-fluoren-9-ylmethyl N-[(3S)-1-diazo-5-methylsulfanyl-2-oxopentan-3-yl]carbamate (CAS 266359-45-9) is a chemical compound with the molecular formula C21H21N3O3S and a molecular weight of 395.5 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(3S)-1-diazo-5-methylsulfanyl-2-oxopentan-3-yl]carbamate. InChIKey: VUKPUSJJOYTIRR-IBGZPJMESA-N.
| Molecular formula | C21H21N3O3S |
|---|---|
| Molecular weight | 395.5 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(3S)-1-diazo-5-methylsulfanyl-2-oxopentan-3-yl]carbamate |
| InChIKey | VUKPUSJJOYTIRR-IBGZPJMESA-N |
| SMILES | CSCC[C@@H](C(=O)C=[N+]=[N-])NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)