Products 17768-34-2
CAS 17768-34-2 appears in our catalog under these names: 2-(3-Bromoadamantan-1-yl)acetic acid, 95+%, 3-Bromo-1-adamantaneacetic acid, 95%, 3–Bromoadamantane–1–acetic acid, 3-Bromoadamantane-1-acetic acid, 2-(3-Bromoadamantan-1-yl)acetic acid, ≥97%, ≥97%. Offered by: AmBeed, Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 10g, 250mg, 1g, 5g.
2-(3-bromo-1-adamantyl)acetic acid (CAS 17768-34-2) is a chemical compound with the molecular formula C12H17BrO2 and a molecular weight of 273.17 g/mol. IUPAC name: 2-(3-bromo-1-adamantyl)acetic acid. InChIKey: HFGLWCBEPPFDDJ-UHFFFAOYSA-N.
| Molecular formula | C12H17BrO2 |
|---|---|
| Molecular weight | 273.17 g/mol |
| IUPAC name | 2-(3-bromo-1-adamantyl)acetic acid |
| InChIKey | HFGLWCBEPPFDDJ-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)Br)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(3-bromoadamantan-1-yl)acetic acid, 3-Bromo-1-adamantaneacetic acid, 2-(3-bromo-1-adamantyl)acetic Acid, Tricyclo[3.3.1.13,7]decane-1-acetic acid, 3-bromo-, 3-Bromoadamantane-1-acetic acid, (3-Bromo-adamantan-1-yl)-acetic acid, (3-bromo-1-adamantyl)acetic acid, 3-bromo-1-adamantylacetic acid, 3-bromoadamantan-1-ylacetic acid, HFGLWCBEPPFDDJ-UHFFFAOYSA-N