CAS 34582-09-7 is the registry number for 1-Bromo-2-(tert-butyl)-4,5-dimethoxybenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-2-tert-butyl-4,5-dimethoxybenzene (CAS 34582-09-7) is a chemical compound with the molecular formula C12H17BrO2 and a molecular weight of 273.17 g/mol. IUPAC name: 1-bromo-2-tert-butyl-4,5-dimethoxybenzene. InChIKey: KSNLIIQBGPQESP-UHFFFAOYSA-N.
| Molecular formula | C12H17BrO2 |
|---|---|
| Molecular weight | 273.17 g/mol |
| IUPAC name | 1-bromo-2-tert-butyl-4,5-dimethoxybenzene |
| InChIKey | KSNLIIQBGPQESP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1Br)OC)OC |
Computed by PubChem (NCBI)