Products 1777782-68-9
CAS 1777782-68-9 is the registry number for Metolcarb-d3. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
(3-methylphenyl) N-(trideuteriomethyl)carbamate (CAS 1777782-68-9) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 168.21 g/mol. IUPAC name: (3-methylphenyl) N-(trideuteriomethyl)carbamate. InChIKey: VOEYXMAFNDNNED-BMSJAHLVSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 168.21 g/mol |
| IUPAC name | (3-methylphenyl) N-(trideuteriomethyl)carbamate |
| InChIKey | VOEYXMAFNDNNED-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])NC(=O)OC1=CC=CC(=C1)C |
Computed by PubChem (NCBI)