Products 177784-98-4
CAS 177784-98-4 is the registry number for Ethyl 4-(tert-butyl)picolinate, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
Ethyl 4-tert-butylpyridine-2-carboxylate (CAS 177784-98-4) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: ethyl 4-tert-butylpyridine-2-carboxylate. InChIKey: YZWTXTGYKVBJCB-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | ethyl 4-tert-butylpyridine-2-carboxylate |
| InChIKey | YZWTXTGYKVBJCB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC=CC(=C1)C(C)(C)C |
Computed by PubChem (NCBI)