Products 1778682-60-2
CAS 1778682-60-2 is the registry number for QND8. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[1-(1-azabicyclo[2.2.2]octan-3-yl)triazol-4-yl]phenol (CAS 1778682-60-2) is a chemical compound with the molecular formula C15H18N4O and a molecular weight of 270.33 g/mol. IUPAC name: 4-[1-(1-azabicyclo[2.2.2]octan-3-yl)triazol-4-yl]phenol. InChIKey: ZRCMYKLGYHVJGO-UHFFFAOYSA-N.
| Molecular formula | C15H18N4O |
|---|---|
| Molecular weight | 270.33 g/mol |
| IUPAC name | 4-[1-(1-azabicyclo[2.2.2]octan-3-yl)triazol-4-yl]phenol |
| InChIKey | ZRCMYKLGYHVJGO-UHFFFAOYSA-N |
| SMILES | C1CN2CCC1C(C2)N3C=C(N=N3)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)