CAS 17788-94-2 appears in our catalog under these names: 4,4''-Dibromo-p-terphenyl4,4''-Dibromo-p-terphenyl, >98%, 4,4''–Dibromo–p–terphenyl, 4,4''-Dibromo-p-terphenyl, 4,4''-Dibromo-p-terphenyl, >95.0%(GC), 4,4''-Dibromo-1,1':4',1''-terphenyl 97%. Offered by: Lumtec, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: On request, 25g, 5g, 10g, 1g, 250mg, 100g.
1,4-bis(4-bromophenyl)benzene (CAS 17788-94-2) is a chemical compound with the molecular formula C18H12Br2 and a molecular weight of 388.1 g/mol. IUPAC name: 1,4-bis(4-bromophenyl)benzene. InChIKey: VAIPJQIPFPRJKJ-UHFFFAOYSA-N.
| Molecular formula | C18H12Br2 |
|---|---|
| Molecular weight | 388.1 g/mol |
| IUPAC name | 1,4-bis(4-bromophenyl)benzene |
| InChIKey | VAIPJQIPFPRJKJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Br)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)