CAS 95962-62-2 appears in our catalog under these names: 3,3''–Dibromo–1,1':3',1''–terphenyl, 3,3''-Dibromo-1,1':3',1''-terphenyl, >97.0%(GC), 3,3''-Dibromo-1,1':3',1''-terphenyl 97%, 3,3''-Dibromo-1,1':3',1''-Terphenyl, 97%, 97%, 3,3''-Dibromo-1,1':3',1''-terphenyl, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 200mg, 100mg, 250mg.
1,3-bis(3-bromophenyl)benzene (CAS 95962-62-2) is a chemical compound with the molecular formula C18H12Br2 and a molecular weight of 388.1 g/mol. IUPAC name: 1,3-bis(3-bromophenyl)benzene. InChIKey: FGKHIPSLESGJNR-UHFFFAOYSA-N.
| Molecular formula | C18H12Br2 |
|---|---|
| Molecular weight | 388.1 g/mol |
| IUPAC name | 1,3-bis(3-bromophenyl)benzene |
| InChIKey | FGKHIPSLESGJNR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=CC=C2)Br)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)