CAS 1779-17-5 appears in our catalog under these names: 5,5'–(Propane–2,2–diyl)bis(isobenzofuran–1,3–dione), 2,2-Bis(3,4-dicarboxyphenyl)propane dianhydride, 98.0%, 98.0%. Offered by: GLPBio, Chemat. Available pack sizes: 10g, 1g, 5g.
5-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]-2-benzofuran-1,3-dione (CAS 1779-17-5) is a chemical compound with the molecular formula C19H12O6 and a molecular weight of 336.3 g/mol. IUPAC name: 5-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]-2-benzofuran-1,3-dione. InChIKey: ALTVSEFNOLOASZ-UHFFFAOYSA-N.
| Molecular formula | C19H12O6 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | 5-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]-2-benzofuran-1,3-dione |
| InChIKey | ALTVSEFNOLOASZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC2=C(C=C1)C(=O)OC2=O)C3=CC4=C(C=C3)C(=O)OC4=O |
Computed by PubChem (NCBI)