Products 1863976-58-2
CAS 1863976-58-2 appears in our catalog under these names: 5-(6-Carboxynaphthalen-2-yl)isophthalic acid, 98%, 5-(6-Carboxynaphthalen-2-yl)isophthalic acid, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg.
5-(6-carboxynaphthalen-2-yl)benzene-1,3-dicarboxylic acid (CAS 1863976-58-2) is a chemical compound with the molecular formula C19H12O6 and a molecular weight of 336.3 g/mol. IUPAC name: 5-(6-carboxynaphthalen-2-yl)benzene-1,3-dicarboxylic acid. InChIKey: DBHDQVOOCQRYMU-UHFFFAOYSA-N.
| Molecular formula | C19H12O6 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | 5-(6-carboxynaphthalen-2-yl)benzene-1,3-dicarboxylic acid |
| InChIKey | DBHDQVOOCQRYMU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C(=O)O)C=C1C3=CC(=CC(=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)