CAS 1779-58-4 appears in our catalog under these names: (Methoxycarbonylmethyl)triphenylphosphonium bromide, (Methoxycarbonylmethyl)triphenylphosphonium bromide, 98+% , Methoxycarbonylmethyl(triphenyl)phosphonium Bromide, >97.0%(HPLC)(T), (2-Methoxy-2-oxoethyl)triphenylphosphonium bromide 97%, (2-Methoxy-2-oxoethyl)triphenylphosphonium Bromide, 97%, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 500g, 25g, 5g, 10g, 1000g, 1kg.
(2-methoxy-2-oxoethyl)-triphenylphosphanium bromide (CAS 1779-58-4) is a chemical compound with the molecular formula C21H20BrO2P and a molecular weight of 415.3 g/mol. IUPAC name: (2-methoxy-2-oxoethyl)-triphenylphosphanium bromide. InChIKey: VCWBQLMDSMSVRL-UHFFFAOYSA-M.
| Molecular formula | C21H20BrO2P |
|---|---|
| Molecular weight | 415.3 g/mol |
| IUPAC name | (2-methoxy-2-oxoethyl)-triphenylphosphanium bromide |
| InChIKey | VCWBQLMDSMSVRL-UHFFFAOYSA-M |
| SMILES | COC(=O)C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)