CAS 51114-94-4 appears in our catalog under these names: (2–Carboxyethyl)triphenylphosphonium bromide, 2-Carboxyethyl(triphenyl)phosphonium bromide, (2-Carboxyethyl)triphenylphosphonium Bromide, >96.0%(HPLC)(T), (2-Carboxyethyl)triphenylphosphonium bromide, 97%, (2-Carboxyethyl)triphenylphosphonium bromide 97%. Offered by: GLPBio, Biosynth, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 100g, 25g, 50g, 5g, 1g, 10g, 500g, 1000g.
2-carboxyethyl(triphenyl)phosphanium bromide (CAS 51114-94-4) is a chemical compound with the molecular formula C21H20BrO2P and a molecular weight of 415.3 g/mol. IUPAC name: 2-carboxyethyl(triphenyl)phosphanium bromide. InChIKey: BVKRDNIULHRLCO-UHFFFAOYSA-N.
| Molecular formula | C21H20BrO2P |
|---|---|
| Molecular weight | 415.3 g/mol |
| IUPAC name | 2-carboxyethyl(triphenyl)phosphanium bromide |
| InChIKey | BVKRDNIULHRLCO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[P+](CCC(=O)O)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)