CAS 1779462-24-6 appears in our catalog under these names: 2-(2-Chlorophenyl)-2-(piperidin-1-yl)acetic acid hydrochloride, 95%, 2-(2-Chlorophenyl)-2-(piperidin-1-yl)acetic acid hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g, 250mg.
2-(2-chlorophenyl)-2-piperidin-1-ylacetic acid;hydrochloride (CAS 1779462-24-6) is a chemical compound with the molecular formula C13H17Cl2NO2 and a molecular weight of 290.18 g/mol. IUPAC name: 2-(2-chlorophenyl)-2-piperidin-1-ylacetic acid;hydrochloride. InChIKey: ZSROTUQDCIPMOX-UHFFFAOYSA-N.
| Molecular formula | C13H17Cl2NO2 |
|---|---|
| Molecular weight | 290.18 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-2-piperidin-1-ylacetic acid;hydrochloride |
| InChIKey | ZSROTUQDCIPMOX-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(C2=CC=CC=C2Cl)C(=O)O.Cl |
Computed by PubChem (NCBI)