Products 1956309-34-4
CAS 1956309-34-4 is the registry number for 2-(4-Chlorophenyl)-2-(piperidin-1-yl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g, 250mg.
2-(4-chlorophenyl)-2-piperidin-1-ylacetic acid;hydrochloride (CAS 1956309-34-4) is a chemical compound with the molecular formula C13H17Cl2NO2 and a molecular weight of 290.18 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-piperidin-1-ylacetic acid;hydrochloride. InChIKey: MAXOOJPISORWLJ-UHFFFAOYSA-N.
| Molecular formula | C13H17Cl2NO2 |
|---|---|
| Molecular weight | 290.18 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-piperidin-1-ylacetic acid;hydrochloride |
| InChIKey | MAXOOJPISORWLJ-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(C2=CC=C(C=C2)Cl)C(=O)O.Cl |
Computed by PubChem (NCBI)