CAS 1779469-52-1 is the registry number for 4-((tert-Butoxy)carbonyl)-4-azaspiro(2.4)heptane-5-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
4-[(2-methylpropan-2-yl)oxycarbonyl]-4-azaspiro[2.4]heptane-5-carboxylic acid (CAS 1779469-52-1) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonyl]-4-azaspiro[2.4]heptane-5-carboxylic acid. InChIKey: SXXIDOHJYDGJJV-UHFFFAOYSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonyl]-4-azaspiro[2.4]heptane-5-carboxylic acid |
| InChIKey | SXXIDOHJYDGJJV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(CCC12CC2)C(=O)O |
Computed by PubChem (NCBI)