Products 177947-88-5
CAS 177947-88-5 is the registry number for tert-Butyl (S)-(1-(4-nitrophenyl)ethyl)carbamate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[(1S)-1-(4-nitrophenyl)ethyl]carbamate (CAS 177947-88-5) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: tert-butyl N-[(1S)-1-(4-nitrophenyl)ethyl]carbamate. InChIKey: XMIOXPAPQXOJLH-VIFPVBQESA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | tert-butyl N-[(1S)-1-(4-nitrophenyl)ethyl]carbamate |
| InChIKey | XMIOXPAPQXOJLH-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)[N+](=O)[O-])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)