CAS 17795-21-0 appears in our catalog under these names: Allopurinol Sodium/ 99.92% (existing batch purity), Allopurinol Sodium, Allopurinol Sodium, 98%, 98%, Allopurinol (sodium), 99.90%, sodium 4-oxo-1H,4H,7H-pyrazolo[3,4-d]pyrimidin-7-ide, 98%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 25g, 100 mg.
Sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate (CAS 17795-21-0) is a chemical compound with the molecular formula C5H3N4NaO and a molecular weight of 158.09 g/mol. IUPAC name: sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate. InChIKey: PTJRZVJXXNYNLN-UHFFFAOYSA-M.
| Molecular formula | C5H3N4NaO |
|---|---|
| Molecular weight | 158.09 g/mol |
| IUPAC name | sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate |
| InChIKey | PTJRZVJXXNYNLN-UHFFFAOYSA-M |
| SMILES | C1=NNC2=C1C(=NC=N2)[O-].[Na+] |
Computed by PubChem (NCBI)