Products 1780209-02-0
CAS 1780209-02-0 is the registry number for tert-Butyl 4-amino-3,3,5,5-tetramethylpiperidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 4-amino-3,3,5,5-tetramethylpiperidine-1-carboxylate (CAS 1780209-02-0) is a chemical compound with the molecular formula C14H28N2O2 and a molecular weight of 256.38 g/mol. IUPAC name: tert-butyl 4-amino-3,3,5,5-tetramethylpiperidine-1-carboxylate. InChIKey: POULDLGIUYUPGX-UHFFFAOYSA-N.
| Molecular formula | C14H28N2O2 |
|---|---|
| Molecular weight | 256.38 g/mol |
| IUPAC name | tert-butyl 4-amino-3,3,5,5-tetramethylpiperidine-1-carboxylate |
| InChIKey | POULDLGIUYUPGX-UHFFFAOYSA-N |
| SMILES | CC1(CN(CC(C1N)(C)C)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)