CAS 1780277-66-8 appears in our catalog under these names: 2-(tert-Butyl)-4,5,6,7-tetrahydro-2H-indazole-3-carboxylic acid, 98%, 2-tert-Butyl-4,5,6,7-tetrahydro-2H-indazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-tert-butyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid (CAS 1780277-66-8) is a chemical compound with the molecular formula C12H18N2O2 and a molecular weight of 222.28 g/mol. IUPAC name: 2-tert-butyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid. InChIKey: LPVHSBCNCHTTMA-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O2 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 2-tert-butyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
| InChIKey | LPVHSBCNCHTTMA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=C2CCCCC2=N1)C(=O)O |
Computed by PubChem (NCBI)