CAS 1780314-31-9 appears in our catalog under these names: 2-(Difluoromethyl)-1,3-benzothiazole-7-carboxylic acid, 95%, 2-(Difluoromethyl)-1,3-benzothiazole-7-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(difluoromethyl)-1,3-benzothiazole-7-carboxylic acid (CAS 1780314-31-9) is a chemical compound with the molecular formula C9H5F2NO2S and a molecular weight of 229.21 g/mol. IUPAC name: 2-(difluoromethyl)-1,3-benzothiazole-7-carboxylic acid. InChIKey: IFBJKRVQKFGLJM-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2S |
|---|---|
| Molecular weight | 229.21 g/mol |
| IUPAC name | 2-(difluoromethyl)-1,3-benzothiazole-7-carboxylic acid |
| InChIKey | IFBJKRVQKFGLJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)N=C(S2)C(F)F)C(=O)O |
Computed by PubChem (NCBI)