CAS 1805773-37-8 appears in our catalog under these names: 2–((Difluoromethyl)thio)isoindoline–1,3–dione, 2-(Difluoromethylsulfanyl)isoindole-1,3-dione, 95%, 95%, 2-((Difluoromethyl)thio)isoindoline-1,3-dione, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
2-(difluoromethylsulfanyl)isoindole-1,3-dione (CAS 1805773-37-8) is a chemical compound with the molecular formula C9H5F2NO2S and a molecular weight of 229.21 g/mol. IUPAC name: 2-(difluoromethylsulfanyl)isoindole-1,3-dione. InChIKey: OQBMFKJNYUEAIV-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2S |
|---|---|
| Molecular weight | 229.21 g/mol |
| IUPAC name | 2-(difluoromethylsulfanyl)isoindole-1,3-dione |
| InChIKey | OQBMFKJNYUEAIV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)SC(F)F |
Computed by PubChem (NCBI)