Products 178032-63-8
CAS 178032-63-8 is the registry number for (1S,2R,6S,7R)-4,4-Dimethyl-3,5-dioxa-8-azatricyclo[5.2.1.0(2,6)]decan-9-one, 95%, 98% ee. Offered by: Thermo Scientific (Acros). Available pack sizes: 1g.
(1S,2R,6S,7R)-4,4-dimethyl-3,5-dioxa-8-azatricyclo[5.2.1.02,6]decan-9-one (CAS 178032-63-8) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 183.20 g/mol. IUPAC name: (1S,2R,6S,7R)-4,4-dimethyl-3,5-dioxa-8-azatricyclo[5.2.1.02,6]decan-9-one. InChIKey: CSGIROCFQXHTKS-WNJXEPBRSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | (1S,2R,6S,7R)-4,4-dimethyl-3,5-dioxa-8-azatricyclo[5.2.1.02,6]decan-9-one |
| InChIKey | CSGIROCFQXHTKS-WNJXEPBRSA-N |
| SMILES | CC1(O[C@@H]2[C@@H]3C[C@H]([C@@H]2O1)NC3=O)C |
Computed by PubChem (NCBI)