Products 1780323-65-0

CAS 1780323-65-0 is the registry number for 3-Methyl-2-(4-(methylthio)benzyl)butanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-methyl-2-[(4-methylsulfanylphenyl)methyl]butanoic acid (CAS 1780323-65-0) is a chemical compound with the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. IUPAC name: 3-methyl-2-[(4-methylsulfanylphenyl)methyl]butanoic acid. InChIKey: POOJFURZBOHPKA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18O2S
Molecular weight238.35 g/mol
IUPAC name3-methyl-2-[(4-methylsulfanylphenyl)methyl]butanoic acid
InChIKeyPOOJFURZBOHPKA-UHFFFAOYSA-N
SMILESCC(C)C(CC1=CC=C(C=C1)SC)C(=O)O

Computed by PubChem (NCBI)