Products 2116866-87-4

CAS 2116866-87-4 is the registry number for Methyl 2,2-dimethyl-3-(3-(methylthio)phenyl)propanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2,2-dimethyl-3-(3-methylsulfanylphenyl)propanoate (CAS 2116866-87-4) is a chemical compound with the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. IUPAC name: methyl 2,2-dimethyl-3-(3-methylsulfanylphenyl)propanoate. InChIKey: POEGYNOTTMAGHK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18O2S
Molecular weight238.35 g/mol
IUPAC namemethyl 2,2-dimethyl-3-(3-methylsulfanylphenyl)propanoate
InChIKeyPOEGYNOTTMAGHK-UHFFFAOYSA-N
SMILESCC(C)(CC1=CC(=CC=C1)SC)C(=O)OC

Computed by PubChem (NCBI)