CAS 1780413-46-8 is the registry number for 6-Isopropylindolin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-propan-2-yl-1,3-dihydroindol-2-one (CAS 1780413-46-8) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 6-propan-2-yl-1,3-dihydroindol-2-one. InChIKey: LSCZTYXUYZBMSX-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 6-propan-2-yl-1,3-dihydroindol-2-one |
| InChIKey | LSCZTYXUYZBMSX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(CC(=O)N2)C=C1 |
Computed by PubChem (NCBI)