CAS 1780801-05-9 is the registry number for 1-bromo-2-(cyclopropylmethoxy)-3,5-dimethylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-bromo-2-(cyclopropylmethoxy)-3,5-dimethylbenzene (CAS 1780801-05-9) is a chemical compound with the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. IUPAC name: 1-bromo-2-(cyclopropylmethoxy)-3,5-dimethylbenzene. InChIKey: GPMKHZBELAJIDO-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO |
|---|---|
| Molecular weight | 255.15 g/mol |
| IUPAC name | 1-bromo-2-(cyclopropylmethoxy)-3,5-dimethylbenzene |
| InChIKey | GPMKHZBELAJIDO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)OCC2CC2)C |
Computed by PubChem (NCBI)