CAS 1780899-17-3 appears in our catalog under these names: (5-(Trifluoromethyl)pyrimidin-2-yl)methanamine hydrochloride, 95+%, (5-(Trifluoromethyl)pyrimidin-2-yl)methanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 0,5g, 50mg.
[5-(trifluoromethyl)pyrimidin-2-yl]methanamine;hydrochloride (CAS 1780899-17-3) is a chemical compound with the molecular formula C6H7ClF3N3 and a molecular weight of 213.59 g/mol. IUPAC name: [5-(trifluoromethyl)pyrimidin-2-yl]methanamine;hydrochloride. InChIKey: TZBVAZCBIRPYOJ-UHFFFAOYSA-N.
| Molecular formula | C6H7ClF3N3 |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | [5-(trifluoromethyl)pyrimidin-2-yl]methanamine;hydrochloride |
| InChIKey | TZBVAZCBIRPYOJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)CN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)