CAS 1971857-88-1 appears in our catalog under these names: (5-(Trifluoromethyl)pyrazin-2-yl)methanamine xhydrochloride, 98%, (5-(Trifluoromethyl)pyrazin-2-yl)methanamine xhydrochloride, 98%, 98%, (5-(Trifluoromethyl)pyrazin-2-yl)methanamine hydrochloride (1:x), 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
[5-(trifluoromethyl)pyrazin-2-yl]methanamine;hydrochloride (CAS 1971857-88-1) is a chemical compound with the molecular formula C6H7ClF3N3 and a molecular weight of 213.59 g/mol. IUPAC name: [5-(trifluoromethyl)pyrazin-2-yl]methanamine;hydrochloride. InChIKey: GNNOZMPQOJKWOU-UHFFFAOYSA-N.
| Molecular formula | C6H7ClF3N3 |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | [5-(trifluoromethyl)pyrazin-2-yl]methanamine;hydrochloride |
| InChIKey | GNNOZMPQOJKWOU-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)C(F)(F)F)CN.Cl |
Computed by PubChem (NCBI)