Products 1781028-61-2

CAS 1781028-61-2 is the registry number for 4,6,6-Trimethylmorpholine-2-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4,6,6-trimethylmorpholine-2-carboxylic acid (CAS 1781028-61-2) is a chemical compound with the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. IUPAC name: 4,6,6-trimethylmorpholine-2-carboxylic acid. InChIKey: QEAZTNFRUQGZAM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15NO3
Molecular weight173.21 g/mol
IUPAC name4,6,6-trimethylmorpholine-2-carboxylic acid
InChIKeyQEAZTNFRUQGZAM-UHFFFAOYSA-N
SMILESCC1(CN(CC(O1)C(=O)O)C)C

Computed by PubChem (NCBI)