CAS 1781241-49-3 is the registry number for 8-Chloro-3-phenyl-6-(trifluoromethyl)imidazo[1,5-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
8-chloro-3-phenyl-6-(trifluoromethyl)imidazo[1,5-a]pyridine (CAS 1781241-49-3) is a chemical compound with the molecular formula C14H8ClF3N2 and a molecular weight of 296.67 g/mol. IUPAC name: 8-chloro-3-phenyl-6-(trifluoromethyl)imidazo[1,5-a]pyridine. InChIKey: IKCNVSWYNPBZMV-UHFFFAOYSA-N.
| Molecular formula | C14H8ClF3N2 |
|---|---|
| Molecular weight | 296.67 g/mol |
| IUPAC name | 8-chloro-3-phenyl-6-(trifluoromethyl)imidazo[1,5-a]pyridine |
| InChIKey | IKCNVSWYNPBZMV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C3N2C=C(C=C3Cl)C(F)(F)F |
Computed by PubChem (NCBI)