CAS 284674-61-9 is the registry number for 8-Chloro-2-phenyl-6-(trifluoromethyl)imidazo[1,2-a]pyridine, 90%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
8-chloro-2-phenyl-6-(trifluoromethyl)imidazo[1,2-a]pyridine (CAS 284674-61-9) is a chemical compound with the molecular formula C14H8ClF3N2 and a molecular weight of 296.67 g/mol. IUPAC name: 8-chloro-2-phenyl-6-(trifluoromethyl)imidazo[1,2-a]pyridine. InChIKey: ATHNSQRFCXRPMB-UHFFFAOYSA-N.
| Molecular formula | C14H8ClF3N2 |
|---|---|
| Molecular weight | 296.67 g/mol |
| IUPAC name | 8-chloro-2-phenyl-6-(trifluoromethyl)imidazo[1,2-a]pyridine |
| InChIKey | ATHNSQRFCXRPMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN3C=C(C=C(C3=N2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)