CAS 178153-07-6 is the registry number for 5-Benzyloxy-D-tryptophan, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(2R)-2-amino-3-(5-phenylmethoxy-1H-indol-3-yl)propanoic acid (CAS 178153-07-6) is a chemical compound with the molecular formula C18H18N2O3 and a molecular weight of 310.3 g/mol. IUPAC name: (2R)-2-amino-3-(5-phenylmethoxy-1H-indol-3-yl)propanoic acid. InChIKey: DFGNDJBYANKHIO-MRXNPFEDSA-N.
| Molecular formula | C18H18N2O3 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | (2R)-2-amino-3-(5-phenylmethoxy-1H-indol-3-yl)propanoic acid |
| InChIKey | DFGNDJBYANKHIO-MRXNPFEDSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)NC=C3C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)